Synonyms:
Decanedionic Acid Bis(2-Ethylhexyl) Ester; Octyl Sebacate; Sebacic Acid Bis (2-Ethylhexyl) Ester;
bis (2-ethylhexyl) sebacate; bisoflex dos; DOS;
2-ethylhexyl sebacate;
1-hexanol, 2-ethyl-, sebacate; monoplex DOS.
Catalog ID Number
Polytrans ID No. is: 010-300-014
CAS Registry Number
CAS RNo. is: 122-62-3
Formula
Chemical formula is: C26H50O4
Structural formula is:
CH3CH2CH2CH2CHCH2OOC(CH2)8COOCH2CHCH2CH2CH2CH3
Molecular Weight
MW is: 426.68 g/mol
To be used for
Dibutyl sebacate is used for PVC and its copolymers modification.
It is widely used for manufacturing of frost-resisting cable plasticator,
leatherette for aircraft and motor transport, PVC linoleum etc. It is also a fine cold-restart plasticizer.
Physical and Chemical properties
| Description | Viscouse colorless or light yellow oil quid liquid with a special small |
| Color (Apha, max) | 30 |
| Ester content (%, min) | 99,0 |
| Acidity (%, max) | 0,02 |
| Flashing point (°C) | 215 |
| Boiling point (°C) | 248 |
| Freezing point (°C) | -55 |
| Density (P 20°Ñ) | 0,913 - 0,919 |
| Refractive Index (at 25°Ñ) | 1,483 |
| Saponification Number | 260 - 270 |
Packing
Dioctyl sebacate is poured into a new galvanized iron drum. Net weight of each drum is 180 kg.